C15H16FN3 — CID 143706949
ethane;6-(4-fluorophenyl)-3-methylimidazo[1,2-a]pyrazine (PubChem CID 143706949) has the molecular formula C15H16FN3 and a molecular weight of 257.31 g/mol. Its IUPAC name is ethane;6-(4-fluorophenyl)-3-methylimidazo[1,2-a]pyrazine.
| Compound Name | ethane;6-(4-fluorophenyl)-3-methylimidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 143706949 |
| Molecular Formula | C15H16FN3 |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | ethane;6-(4-fluorophenyl)-3-methylimidazo[1,2-a]pyrazine |
| SMILES | CC.Cc1cnc2cnc(-c3ccc(F)cc3)cn12 |
| InChI | InChI=1S/C13H10FN3.C2H6/c1-9-6-16-13-7-15-12(8-17(9)13)10-2-4-11(14)5-3-10;1-2/h2-8H,1H3;1-2H3 |
| InChIKey | ZRVCXWPMZGCJLV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |