C13H15F3N2 — CID 145149010
1-(2,2-difluoroethyl)-4-(4-fluorophenyl)imidazole;ethane (PubChem CID 145149010) has the molecular formula C13H15F3N2 and a molecular weight of 256.27 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-4-(4-fluorophenyl)imidazole;ethane.
| Compound Name | 1-(2,2-difluoroethyl)-4-(4-fluorophenyl)imidazole;ethane |
|---|---|
| PubChem CID | 145149010 |
| Molecular Formula | C13H15F3N2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 1-(2,2-difluoroethyl)-4-(4-fluorophenyl)imidazole;ethane |
| SMILES | CC.Fc1ccc(-c2cn(CC(F)F)cn2)cc1 |
| InChI | InChI=1S/C11H9F3N2.C2H6/c12-9-3-1-8(2-4-9)10-5-16(7-15-10)6-11(13)14;1-2/h1-5,7,11H,6H2;1-2H3 |
| InChIKey | OGXAUJFPWFLPSW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |