C8H8FN3O — CID 130065507
6-fluoro-8-methoxyimidazo[1,2-a]pyridin-3-amine (PubChem CID 130065507) has the molecular formula C8H8FN3O and a molecular weight of 181.17 g/mol. Its IUPAC name is 6-fluoro-8-methoxyimidazo[1,2-a]pyridin-3-amine.
| Compound Name | 6-fluoro-8-methoxyimidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 130065507 |
| Molecular Formula | C8H8FN3O |
| Molecular Weight | 181.17 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 6-fluoro-8-methoxyimidazo[1,2-a]pyridin-3-amine |
| SMILES | COc1cc(F)cn2c(N)cnc12 |
| InChI | InChI=1S/C8H8FN3O/c1-13-6-2-5(9)4-12-7(10)3-11-8(6)12/h2-4H,10H2,1H3 |
| InChIKey | ACVUCKSCUXEKGO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.17 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |