C17H22O5S — CID 13006761
methyl 2-[(3aS,4S,6S,6aS)-2,2-dimethyl-4-(phenylsulfanylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetate (PubChem CID 13006761) has the molecular formula C17H22O5S and a molecular weight of 338.43 g/mol. Its IUPAC name is methyl 2-[(3aS,4S,6S,6aS)-2,2-dimethyl-4-(phenylsulfanylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetate.
| Compound Name | methyl 2-[(3aS,4S,6S,6aS)-2,2-dimethyl-4-(phenylsulfanylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetate |
|---|---|
| PubChem CID | 13006761 |
| Molecular Formula | C17H22O5S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | methyl 2-[(3aS,4S,6S,6aS)-2,2-dimethyl-4-(phenylsulfanylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetate |
| SMILES | COC(=O)C[C@@H]1O[C@H](CSc2ccccc2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C17H22O5S/c1-17(2)21-15-12(9-14(18)19-3)20-13(16(15)22-17)10-23-11-7-5-4-6-8-11/h4-8,12-13,15-16H,9-10H2,1-3H3/t12-,13+,15-,16+/m0/s1 |
| InChIKey | YSWGFTWXXQIVHV-LQKXBSAESA-N |
| XLogP | 2.63 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |