C8H4F2N2O3 — CID 130076877
6-cyano-2-(difluoromethyl)-3-hydroxypyridine-4-carboxylic acid (PubChem CID 130076877) has the molecular formula C8H4F2N2O3 and a molecular weight of 214.13 g/mol. Its IUPAC name is 6-cyano-2-(difluoromethyl)-3-hydroxypyridine-4-carboxylic acid.
| Compound Name | 6-cyano-2-(difluoromethyl)-3-hydroxypyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 130076877 |
| Molecular Formula | C8H4F2N2O3 |
| Molecular Weight | 214.13 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | 6-cyano-2-(difluoromethyl)-3-hydroxypyridine-4-carboxylic acid |
| SMILES | N#Cc1cc(C(=O)O)c(O)c(C(F)F)n1 |
| InChI | InChI=1S/C8H4F2N2O3/c9-7(10)5-6(13)4(8(14)15)1-3(2-11)12-5/h1,7,13H,(H,14,15) |
| InChIKey | BRQGKJKQPXWBBP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 94.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.13 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |