C10H9F2N3O2 — CID 118801084
2-[4-(aminomethyl)-6-cyano-2-(difluoromethyl)-3-pyridinyl]acetic acid (PubChem CID 118801084) has the molecular formula C10H9F2N3O2 and a molecular weight of 241.20 g/mol. Its IUPAC name is 2-[4-(aminomethyl)-6-cyano-2-(difluoromethyl)-3-pyridinyl]acetic acid.
| Compound Name | 2-[4-(aminomethyl)-6-cyano-2-(difluoromethyl)-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 118801084 |
| Molecular Formula | C10H9F2N3O2 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 2-[4-(aminomethyl)-6-cyano-2-(difluoromethyl)-3-pyridinyl]acetic acid |
| SMILES | N#Cc1cc(CN)c(CC(=O)O)c(C(F)F)n1 |
| InChI | InChI=1S/C10H9F2N3O2/c11-10(12)9-7(2-8(16)17)5(3-13)1-6(4-14)15-9/h1,10H,2-3,13H2,(H,16,17) |
| InChIKey | UZSCDISDJBRPFL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |