C10H9F2N3O2 — CID 133107066
methyl 4-(aminomethyl)-6-cyano-2-(difluoromethyl)pyridine-3-carboxylate (PubChem CID 133107066) has the molecular formula C10H9F2N3O2 and a molecular weight of 241.20 g/mol. Its IUPAC name is methyl 4-(aminomethyl)-6-cyano-2-(difluoromethyl)pyridine-3-carboxylate.
| Compound Name | methyl 4-(aminomethyl)-6-cyano-2-(difluoromethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 133107066 |
| Molecular Formula | C10H9F2N3O2 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | methyl 4-(aminomethyl)-6-cyano-2-(difluoromethyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(CN)cc(C#N)nc1C(F)F |
| InChI | InChI=1S/C10H9F2N3O2/c1-17-10(16)7-5(3-13)2-6(4-14)15-8(7)9(11)12/h2,9H,3,13H2,1H3 |
| InChIKey | JSZZMQXHUZLRLK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |