C7H3ClF2N2O3S — CID 130077018
6-cyano-4-(difluoromethyl)-2-oxo-1H-pyridine-3-sulfonyl chloride (PubChem CID 130077018) has the molecular formula C7H3ClF2N2O3S and a molecular weight of 268.63 g/mol. Its IUPAC name is 6-cyano-4-(difluoromethyl)-2-oxo-1H-pyridine-3-sulfonyl chloride.
| Compound Name | 6-cyano-4-(difluoromethyl)-2-oxo-1H-pyridine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 130077018 |
| Molecular Formula | C7H3ClF2N2O3S |
| Molecular Weight | 268.63 g/mol |
| Exact Mass | 267.95 |
| IUPAC Name | 6-cyano-4-(difluoromethyl)-2-oxo-1H-pyridine-3-sulfonyl chloride |
| SMILES | N#Cc1cc(C(F)F)c(S(=O)(=O)Cl)c(=O)[nH]1 |
| InChI | InChI=1S/C7H3ClF2N2O3S/c8-16(14,15)5-4(6(9)10)1-3(2-11)12-7(5)13/h1,6H,(H,12,13) |
| InChIKey | KLGBKHSMMZKYEB-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.63 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |