C8H3F5N2O — CID 130076699
5-(difluoromethyl)-6-oxo-4-(trifluoromethyl)-1H-pyridine-2-carbonitrile (PubChem CID 130076699) has the molecular formula C8H3F5N2O and a molecular weight of 238.11 g/mol. Its IUPAC name is 5-(difluoromethyl)-6-oxo-4-(trifluoromethyl)-1H-pyridine-2-carbonitrile.
| Compound Name | 5-(difluoromethyl)-6-oxo-4-(trifluoromethyl)-1H-pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 130076699 |
| Molecular Formula | C8H3F5N2O |
| Molecular Weight | 238.11 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 5-(difluoromethyl)-6-oxo-4-(trifluoromethyl)-1H-pyridine-2-carbonitrile |
| SMILES | N#Cc1cc(C(F)(F)F)c(C(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C8H3F5N2O/c9-6(10)5-4(8(11,12)13)1-3(2-14)15-7(5)16/h1,6H,(H,15,16) |
| InChIKey | VKUPBJBNCGKUJN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.11 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |