C8H6F2N2O2 — CID 130100201
2-[5-(difluoromethyl)-4-hydroxy-6-oxo-1H-pyridin-2-yl]acetonitrile (PubChem CID 130100201) has the molecular formula C8H6F2N2O2 and a molecular weight of 200.14 g/mol. Its IUPAC name is 2-[5-(difluoromethyl)-4-hydroxy-6-oxo-1H-pyridin-2-yl]acetonitrile.
| Compound Name | 2-[5-(difluoromethyl)-4-hydroxy-6-oxo-1H-pyridin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 130100201 |
| Molecular Formula | C8H6F2N2O2 |
| Molecular Weight | 200.14 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 2-[5-(difluoromethyl)-4-hydroxy-6-oxo-1H-pyridin-2-yl]acetonitrile |
| SMILES | N#CCc1cc(O)c(C(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C8H6F2N2O2/c9-7(10)6-5(13)3-4(1-2-11)12-8(6)14/h3,7H,1H2,(H2,12,13,14) |
| InChIKey | KJEQDGNXIFNIOL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.14 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |