C20H19N3O4S2 — CID 1300781
(7R)-3,7-dimethyl-2-[2-(4-nitrophenyl)-2-oxoethyl]sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 1300781) has the molecular formula C20H19N3O4S2 and a molecular weight of 429.52 g/mol. Its IUPAC name is (7R)-3,7-dimethyl-2-[2-(4-nitrophenyl)-2-oxoethyl]sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (7R)-3,7-dimethyl-2-[2-(4-nitrophenyl)-2-oxoethyl]sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 1300781 |
| Molecular Formula | C20H19N3O4S2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | (7R)-3,7-dimethyl-2-[2-(4-nitrophenyl)-2-oxoethyl]sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | C[C@@H]1CCc2c(sc3nc(SCC(=O)c4ccc([N+](=O)[O-])cc4)n(C)c(=O)c23)C1 |
| InChI | InChI=1S/C20H19N3O4S2/c1-11-3-8-14-16(9-11)29-18-17(14)19(25)22(2)20(21-18)28-10-15(24)12-4-6-13(7-5-12)23(26)27/h4-7,11H,3,8-10H2,1-2H3/t11-/m1/s1 |
| InChIKey | MHFFZDFCKYDMTK-LLVKDONJSA-N |
| XLogP | 4.00 |
| TPSA | 95.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|