C9H6F2N2O2 — CID 130078420
3-cyano-5-(difluoromethyl)-4-methylpyridine-2-carboxylic acid (PubChem CID 130078420) has the molecular formula C9H6F2N2O2 and a molecular weight of 212.16 g/mol. Its IUPAC name is 3-cyano-5-(difluoromethyl)-4-methylpyridine-2-carboxylic acid.
| Compound Name | 3-cyano-5-(difluoromethyl)-4-methylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 130078420 |
| Molecular Formula | C9H6F2N2O2 |
| Molecular Weight | 212.16 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 3-cyano-5-(difluoromethyl)-4-methylpyridine-2-carboxylic acid |
| SMILES | Cc1c(C(F)F)cnc(C(=O)O)c1C#N |
| InChI | InChI=1S/C9H6F2N2O2/c1-4-5(2-12)7(9(14)15)13-3-6(4)8(10)11/h3,8H,1H3,(H,14,15) |
| InChIKey | POMVUEONCWIRIE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.16 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |