C7H5BrF2INO — CID 130082661
4-(bromomethyl)-5-(difluoromethyl)-3-iodo-1H-pyridin-2-one (PubChem CID 130082661) has the molecular formula C7H5BrF2INO and a molecular weight of 363.93 g/mol. Its IUPAC name is 4-(bromomethyl)-5-(difluoromethyl)-3-iodo-1H-pyridin-2-one.
| Compound Name | 4-(bromomethyl)-5-(difluoromethyl)-3-iodo-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130082661 |
| Molecular Formula | C7H5BrF2INO |
| Molecular Weight | 363.93 g/mol |
| Exact Mass | 362.86 |
| IUPAC Name | 4-(bromomethyl)-5-(difluoromethyl)-3-iodo-1H-pyridin-2-one |
| SMILES | O=c1[nH]cc(C(F)F)c(CBr)c1I |
| InChI | InChI=1S/C7H5BrF2INO/c8-1-3-4(6(9)10)2-12-7(13)5(3)11/h2,6H,1H2,(H,12,13) |
| InChIKey | GYOARTDUQFKMNK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.93 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|