C7H6F2N2O4 — CID 130084380
5-(difluoromethyl)-2-(hydroxymethyl)-3-nitro-1H-pyridin-4-one (PubChem CID 130084380) has the molecular formula C7H6F2N2O4 and a molecular weight of 220.13 g/mol. Its IUPAC name is 5-(difluoromethyl)-2-(hydroxymethyl)-3-nitro-1H-pyridin-4-one.
| Compound Name | 5-(difluoromethyl)-2-(hydroxymethyl)-3-nitro-1H-pyridin-4-one |
|---|---|
| PubChem CID | 130084380 |
| Molecular Formula | C7H6F2N2O4 |
| Molecular Weight | 220.13 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 5-(difluoromethyl)-2-(hydroxymethyl)-3-nitro-1H-pyridin-4-one |
| SMILES | O=c1c(C(F)F)c[nH]c(CO)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H6F2N2O4/c8-7(9)3-1-10-4(2-12)5(6(3)13)11(14)15/h1,7,12H,2H2,(H,10,13) |
| InChIKey | VMEBNNOXHYYRIJ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.13 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|