C7H7F3N2O — CID 118853919
2-(aminomethyl)-5-(difluoromethyl)-3-fluoro-1H-pyridin-4-one (PubChem CID 118853919) has the molecular formula C7H7F3N2O and a molecular weight of 192.14 g/mol. Its IUPAC name is 2-(aminomethyl)-5-(difluoromethyl)-3-fluoro-1H-pyridin-4-one.
| Compound Name | 2-(aminomethyl)-5-(difluoromethyl)-3-fluoro-1H-pyridin-4-one |
|---|---|
| PubChem CID | 118853919 |
| Molecular Formula | C7H7F3N2O |
| Molecular Weight | 192.14 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 2-(aminomethyl)-5-(difluoromethyl)-3-fluoro-1H-pyridin-4-one |
| SMILES | NCc1[nH]cc(C(F)F)c(=O)c1F |
| InChI | InChI=1S/C7H7F3N2O/c8-5-4(1-11)12-2-3(6(5)13)7(9)10/h2,7H,1,11H2,(H,12,13) |
| InChIKey | AAUDLRYFELOPPM-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.14 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |