C8H4F5NO2 — CID 130085424
5-(difluoromethyl)-4-oxo-3-(trifluoromethyl)-1H-pyridine-2-carbaldehyde (PubChem CID 130085424) has the molecular formula C8H4F5NO2 and a molecular weight of 241.12 g/mol. Its IUPAC name is 5-(difluoromethyl)-4-oxo-3-(trifluoromethyl)-1H-pyridine-2-carbaldehyde.
| Compound Name | 5-(difluoromethyl)-4-oxo-3-(trifluoromethyl)-1H-pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 130085424 |
| Molecular Formula | C8H4F5NO2 |
| Molecular Weight | 241.12 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 5-(difluoromethyl)-4-oxo-3-(trifluoromethyl)-1H-pyridine-2-carbaldehyde |
| SMILES | O=Cc1[nH]cc(C(F)F)c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C8H4F5NO2/c9-7(10)3-1-14-4(2-15)5(6(3)16)8(11,12)13/h1-2,7H,(H,14,16) |
| InChIKey | QOKARDTVSQAURP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.12 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|