C7H3F6NO — CID 130079521
2-(difluoromethyl)-5-fluoro-3-(trifluoromethyl)-1H-pyridin-4-one (PubChem CID 130079521) has the molecular formula C7H3F6NO and a molecular weight of 231.10 g/mol. Its IUPAC name is 2-(difluoromethyl)-5-fluoro-3-(trifluoromethyl)-1H-pyridin-4-one.
| Compound Name | 2-(difluoromethyl)-5-fluoro-3-(trifluoromethyl)-1H-pyridin-4-one |
|---|---|
| PubChem CID | 130079521 |
| Molecular Formula | C7H3F6NO |
| Molecular Weight | 231.10 g/mol |
| Exact Mass | 231.01 |
| IUPAC Name | 2-(difluoromethyl)-5-fluoro-3-(trifluoromethyl)-1H-pyridin-4-one |
| SMILES | O=c1c(F)c[nH]c(C(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C7H3F6NO/c8-2-1-14-4(6(9)10)3(5(2)15)7(11,12)13/h1,6H,(H,14,15) |
| InChIKey | GPXWJMUPITVNCT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.10 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |