C6H5F3N2O — CID 130103823
3-amino-2-(difluoromethyl)-5-fluoro-1H-pyridin-4-one (PubChem CID 130103823) has the molecular formula C6H5F3N2O and a molecular weight of 178.11 g/mol. Its IUPAC name is 3-amino-2-(difluoromethyl)-5-fluoro-1H-pyridin-4-one.
| Compound Name | 3-amino-2-(difluoromethyl)-5-fluoro-1H-pyridin-4-one |
|---|---|
| PubChem CID | 130103823 |
| Molecular Formula | C6H5F3N2O |
| Molecular Weight | 178.11 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 3-amino-2-(difluoromethyl)-5-fluoro-1H-pyridin-4-one |
| SMILES | Nc1c(C(F)F)[nH]cc(F)c1=O |
| InChI | InChI=1S/C6H5F3N2O/c7-2-1-11-4(6(8)9)3(10)5(2)12/h1,6H,10H2,(H,11,12) |
| InChIKey | JVIOLQLQOLCYCS-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.11 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |