C6H4F4N2O2 — CID 130909704
3-amino-5-fluoro-2-(trifluoromethoxy)-1H-pyridin-4-one (PubChem CID 130909704) has the molecular formula C6H4F4N2O2 and a molecular weight of 212.10 g/mol. Its IUPAC name is 3-amino-5-fluoro-2-(trifluoromethoxy)-1H-pyridin-4-one.
| Compound Name | 3-amino-5-fluoro-2-(trifluoromethoxy)-1H-pyridin-4-one |
|---|---|
| PubChem CID | 130909704 |
| Molecular Formula | C6H4F4N2O2 |
| Molecular Weight | 212.10 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 3-amino-5-fluoro-2-(trifluoromethoxy)-1H-pyridin-4-one |
| SMILES | Nc1c(OC(F)(F)F)[nH]cc(F)c1=O |
| InChI | InChI=1S/C6H4F4N2O2/c7-2-1-12-5(3(11)4(2)13)14-6(8,9)10/h1H,11H2,(H,12,13) |
| InChIKey | DDXUPHLIABJZQQ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.10 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |