C25H19FN2O3 — CID 1300898
N-(4-fluorophenyl)-2-[(2-naphthalen-2-yloxyacetyl)amino]benzamide (PubChem CID 1300898) has the molecular formula C25H19FN2O3 and a molecular weight of 414.44 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[(2-naphthalen-2-yloxyacetyl)amino]benzamide.
| Compound Name | N-(4-fluorophenyl)-2-[(2-naphthalen-2-yloxyacetyl)amino]benzamide |
|---|---|
| PubChem CID | 1300898 |
| Molecular Formula | C25H19FN2O3 |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | N-(4-fluorophenyl)-2-[(2-naphthalen-2-yloxyacetyl)amino]benzamide |
| SMILES | O=C(COc1ccc2ccccc2c1)Nc1ccccc1C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C25H19FN2O3/c26-19-10-12-20(13-11-19)27-25(30)22-7-3-4-8-23(22)28-24(29)16-31-21-14-9-17-5-1-2-6-18(17)15-21/h1-15H,16H2,(H,27,30)(H,28,29) |
| InChIKey | PUIFSZHQQLUYJQ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |