C10H10BrF2NO2 — CID 130090297
2-[5-(bromomethyl)-2-(difluoromethyl)-4-methyl-3-pyridinyl]acetic acid (PubChem CID 130090297) has the molecular formula C10H10BrF2NO2 and a molecular weight of 294.10 g/mol. Its IUPAC name is 2-[5-(bromomethyl)-2-(difluoromethyl)-4-methyl-3-pyridinyl]acetic acid.
| Compound Name | 2-[5-(bromomethyl)-2-(difluoromethyl)-4-methyl-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 130090297 |
| Molecular Formula | C10H10BrF2NO2 |
| Molecular Weight | 294.10 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | 2-[5-(bromomethyl)-2-(difluoromethyl)-4-methyl-3-pyridinyl]acetic acid |
| SMILES | Cc1c(CBr)cnc(C(F)F)c1CC(=O)O |
| InChI | InChI=1S/C10H10BrF2NO2/c1-5-6(3-11)4-14-9(10(12)13)7(5)2-8(15)16/h4,10H,2-3H2,1H3,(H,15,16) |
| InChIKey | PMBYKVDKKNOWRZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.10 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|