C9H10BrF2N — CID 130101296
5-(bromomethyl)-2-(difluoromethyl)-3,4-dimethylpyridine (PubChem CID 130101296) has the molecular formula C9H10BrF2N and a molecular weight of 250.09 g/mol. Its IUPAC name is 5-(bromomethyl)-2-(difluoromethyl)-3,4-dimethylpyridine.
| Compound Name | 5-(bromomethyl)-2-(difluoromethyl)-3,4-dimethylpyridine |
|---|---|
| PubChem CID | 130101296 |
| Molecular Formula | C9H10BrF2N |
| Molecular Weight | 250.09 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | 5-(bromomethyl)-2-(difluoromethyl)-3,4-dimethylpyridine |
| SMILES | Cc1c(CBr)cnc(C(F)F)c1C |
| InChI | InChI=1S/C9H10BrF2N/c1-5-6(2)8(9(11)12)13-4-7(5)3-10/h4,9H,3H2,1-2H3 |
| InChIKey | PHCPGASOQBTYJN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.09 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|