C5H6Br2N2S — CID 130090847
1-(2,4-dibromo-1,3-thiazol-5-yl)ethanamine (PubChem CID 130090847) has the molecular formula C5H6Br2N2S and a molecular weight of 285.99 g/mol. Its IUPAC name is 1-(2,4-dibromo-1,3-thiazol-5-yl)ethanamine.
| Compound Name | 1-(2,4-dibromo-1,3-thiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 130090847 |
| Molecular Formula | C5H6Br2N2S |
| Molecular Weight | 285.99 g/mol |
| Exact Mass | 283.86 |
| IUPAC Name | 1-(2,4-dibromo-1,3-thiazol-5-yl)ethanamine |
| SMILES | CC(N)c1sc(Br)nc1Br |
| InChI | InChI=1S/C5H6Br2N2S/c1-2(8)3-4(6)9-5(7)10-3/h2H,8H2,1H3 |
| InChIKey | OEIXKHVRLPWZBM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.99 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |