C11H14FNO3 — CID 13009134
2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-6-fluoropyridine (PubChem CID 13009134) has the molecular formula C11H14FNO3 and a molecular weight of 227.23 g/mol. Its IUPAC name is 2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-6-fluoropyridine.
| Compound Name | 2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-6-fluoropyridine |
|---|---|
| PubChem CID | 13009134 |
| Molecular Formula | C11H14FNO3 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-6-fluoropyridine |
| SMILES | CC1(C)OCC(COc2cccc(F)n2)O1 |
| InChI | InChI=1S/C11H14FNO3/c1-11(2)15-7-8(16-11)6-14-10-5-3-4-9(12)13-10/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | DEACZIYYKZKMRB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|