About 3-fluoro-2,6-dimethoxypyridine
3-fluoro-2,6-dimethoxypyridine (PubChem CID 130784380) has the molecular formula C7H8FNO2
and a molecular weight of 157.14 g/mol. Its IUPAC name is 3-fluoro-2,6-dimethoxypyridine.
Molecular Properties
| Compound Name | 3-fluoro-2,6-dimethoxypyridine |
| PubChem CID | 130784380 |
| Molecular Formula | C7H8FNO2 |
| Molecular Weight | 157.14 g/mol |
| Exact Mass | 157.05 |
| IUPAC Name | 3-fluoro-2,6-dimethoxypyridine |
| SMILES | COc1ccc(F)c(OC)n1 |
| InChI | InChI=1S/C7H8FNO2/c1-10-6-4-3-5(8)7(9-6)11-2/h3-4H,1-2H3 |
| InChIKey | CXVIDVFWJZYFCV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.14 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-fluoro-2,6-dimethoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2,6-dimethoxypyridine?
The IUPAC name of 3-fluoro-2,6-dimethoxypyridine (CID 130784380) is 3-fluoro-2,6-dimethoxypyridine.
What is the SMILES notation for 3-fluoro-2,6-dimethoxypyridine?
The canonical SMILES for 3-fluoro-2,6-dimethoxypyridine is COc1ccc(F)c(OC)n1.
What is the InChIKey of 3-fluoro-2,6-dimethoxypyridine?
The InChIKey is CXVIDVFWJZYFCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8FNO2/c1-10-6-4-3-5(8)7(9-6)11-2/h3-4H,1-2H3.
What are the key properties of 3-fluoro-2,6-dimethoxypyridine?
3-fluoro-2,6-dimethoxypyridine has a molecular weight of 157.14 g/mol, XLogP of 1.24, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2,6-dimethoxypyridine is sourced from PubChem (CID 130784380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).