C7H5Cl2F3N2O — CID 130093865
[4,6-dichloro-5-(trifluoromethoxy)-2-pyridinyl]methanamine (PubChem CID 130093865) has the molecular formula C7H5Cl2F3N2O and a molecular weight of 261.03 g/mol. Its IUPAC name is [4,6-dichloro-5-(trifluoromethoxy)-2-pyridinyl]methanamine.
| Compound Name | [4,6-dichloro-5-(trifluoromethoxy)-2-pyridinyl]methanamine |
|---|---|
| PubChem CID | 130093865 |
| Molecular Formula | C7H5Cl2F3N2O |
| Molecular Weight | 261.03 g/mol |
| Exact Mass | 259.97 |
| IUPAC Name | [4,6-dichloro-5-(trifluoromethoxy)-2-pyridinyl]methanamine |
| SMILES | NCc1cc(Cl)c(OC(F)(F)F)c(Cl)n1 |
| InChI | InChI=1S/C7H5Cl2F3N2O/c8-4-1-3(2-13)14-6(9)5(4)15-7(10,11)12/h1H,2,13H2 |
| InChIKey | QVQUVWKNCOXCTL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.03 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|