C6H3Cl2F3N2O — CID 130093745
4,6-dichloro-5-(trifluoromethoxy)pyridin-2-amine (PubChem CID 130093745) has the molecular formula C6H3Cl2F3N2O and a molecular weight of 247.00 g/mol. Its IUPAC name is 4,6-dichloro-5-(trifluoromethoxy)pyridin-2-amine.
| Compound Name | 4,6-dichloro-5-(trifluoromethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 130093745 |
| Molecular Formula | C6H3Cl2F3N2O |
| Molecular Weight | 247.00 g/mol |
| Exact Mass | 245.96 |
| IUPAC Name | 4,6-dichloro-5-(trifluoromethoxy)pyridin-2-amine |
| SMILES | Nc1cc(Cl)c(OC(F)(F)F)c(Cl)n1 |
| InChI | InChI=1S/C6H3Cl2F3N2O/c7-2-1-3(12)13-5(8)4(2)14-6(9,10)11/h1H,(H2,12,13) |
| InChIKey | WWJRVVLQEQDEGQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.00 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|