C6H5ClF2N2O2S — CID 130094943
2-amino-5-(difluoromethyl)pyridine-4-sulfonyl chloride (PubChem CID 130094943) has the molecular formula C6H5ClF2N2O2S and a molecular weight of 242.63 g/mol. Its IUPAC name is 2-amino-5-(difluoromethyl)pyridine-4-sulfonyl chloride.
| Compound Name | 2-amino-5-(difluoromethyl)pyridine-4-sulfonyl chloride |
|---|---|
| PubChem CID | 130094943 |
| Molecular Formula | C6H5ClF2N2O2S |
| Molecular Weight | 242.63 g/mol |
| Exact Mass | 241.97 |
| IUPAC Name | 2-amino-5-(difluoromethyl)pyridine-4-sulfonyl chloride |
| SMILES | Nc1cc(S(=O)(=O)Cl)c(C(F)F)cn1 |
| InChI | InChI=1S/C6H5ClF2N2O2S/c7-14(12,13)4-1-5(10)11-2-3(4)6(8)9/h1-2,6H,(H2,10,11) |
| InChIKey | CACJCERLOUMQMT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.63 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |