C7H7ClF2N2O2S — CID 134664079
5-(aminomethyl)-2-(difluoromethyl)pyridine-3-sulfonyl chloride (PubChem CID 134664079) has the molecular formula C7H7ClF2N2O2S and a molecular weight of 256.66 g/mol. Its IUPAC name is 5-(aminomethyl)-2-(difluoromethyl)pyridine-3-sulfonyl chloride.
| Compound Name | 5-(aminomethyl)-2-(difluoromethyl)pyridine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 134664079 |
| Molecular Formula | C7H7ClF2N2O2S |
| Molecular Weight | 256.66 g/mol |
| Exact Mass | 255.99 |
| IUPAC Name | 5-(aminomethyl)-2-(difluoromethyl)pyridine-3-sulfonyl chloride |
| SMILES | NCc1cnc(C(F)F)c(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C7H7ClF2N2O2S/c8-15(13,14)5-1-4(2-11)3-12-6(5)7(9)10/h1,3,7H,2,11H2 |
| InChIKey | MJRXZHFIMFABQS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.66 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |