C6H5BrF2N2O2S — CID 130095356
5-bromo-2-(difluoromethyl)pyridine-3-sulfonamide (PubChem CID 130095356) has the molecular formula C6H5BrF2N2O2S and a molecular weight of 287.08 g/mol. Its IUPAC name is 5-bromo-2-(difluoromethyl)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-(difluoromethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 130095356 |
| Molecular Formula | C6H5BrF2N2O2S |
| Molecular Weight | 287.08 g/mol |
| Exact Mass | 285.92 |
| IUPAC Name | 5-bromo-2-(difluoromethyl)pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1cc(Br)cnc1C(F)F |
| InChI | InChI=1S/C6H5BrF2N2O2S/c7-3-1-4(14(10,12)13)5(6(8)9)11-2-3/h1-2,6H,(H2,10,12,13) |
| InChIKey | LHDQYXFCUOECSR-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.08 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |