C9H9F2N3 — CID 130098006
2-[5-(aminomethyl)-6-(difluoromethyl)-3-pyridinyl]acetonitrile (PubChem CID 130098006) has the molecular formula C9H9F2N3 and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-[5-(aminomethyl)-6-(difluoromethyl)-3-pyridinyl]acetonitrile.
| Compound Name | 2-[5-(aminomethyl)-6-(difluoromethyl)-3-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 130098006 |
| Molecular Formula | C9H9F2N3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 2-[5-(aminomethyl)-6-(difluoromethyl)-3-pyridinyl]acetonitrile |
| SMILES | N#CCc1cnc(C(F)F)c(CN)c1 |
| InChI | InChI=1S/C9H9F2N3/c10-9(11)8-7(4-13)3-6(1-2-12)5-14-8/h3,5,9H,1,4,13H2 |
| InChIKey | WNFBAFWFYGAYLD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |