C6H2Br2ClF2NO2S — CID 130099148
3,5-dibromo-6-(difluoromethyl)pyridine-2-sulfonyl chloride (PubChem CID 130099148) has the molecular formula C6H2Br2ClF2NO2S and a molecular weight of 385.41 g/mol. Its IUPAC name is 3,5-dibromo-6-(difluoromethyl)pyridine-2-sulfonyl chloride.
| Compound Name | 3,5-dibromo-6-(difluoromethyl)pyridine-2-sulfonyl chloride |
|---|---|
| PubChem CID | 130099148 |
| Molecular Formula | C6H2Br2ClF2NO2S |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 382.78 |
| IUPAC Name | 3,5-dibromo-6-(difluoromethyl)pyridine-2-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1nc(C(F)F)c(Br)cc1Br |
| InChI | InChI=1S/C6H2Br2ClF2NO2S/c7-2-1-3(8)6(15(9,13)14)12-4(2)5(10)11/h1,5H |
| InChIKey | JJVMJNCHMWIKPY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |