3,5-dibromo-6-(difluoromethyl)pyridine-2-sulfonyl chloride

C6H2Br2ClF2NO2S — CID 130099148

IUPAC3,5-dibromo-6-(difluoromethyl)pyridine-2-sulfonyl chloride
SMILESO=S(=O)(Cl)c1nc(C(F)F)c(Br)cc1Br
InChIInChI=1S/C6H2Br2ClF2NO2S/c7-2-1-3(8)6(15(9,13)14)12-4(2)5(10)11/h1,5H
InChIKeyJJVMJNCHMWIKPY-UHFFFAOYSA-N
MW385.41 g/mol
LogP3.47
Rot. Bonds2

About 3,5-dibromo-6-(difluoromethyl)pyridine-2-sulfonyl chloride

3,5-dibromo-6-(difluoromethyl)pyridine-2-sulfonyl chloride (PubChem CID 130099148) has the molecular formula C6H2Br2ClF2NO2S and a molecular weight of 385.41 g/mol. Its IUPAC name is 3,5-dibromo-6-(difluoromethyl)pyridine-2-sulfonyl chloride.

Molecular Properties

Compound Name3,5-dibromo-6-(difluoromethyl)pyridine-2-sulfonyl chloride
PubChem CID130099148
Molecular FormulaC6H2Br2ClF2NO2S
Molecular Weight385.41 g/mol
Exact Mass382.78
IUPAC Name3,5-dibromo-6-(difluoromethyl)pyridine-2-sulfonyl chloride
SMILESO=S(=O)(Cl)c1nc(C(F)F)c(Br)cc1Br
InChIInChI=1S/C6H2Br2ClF2NO2S/c7-2-1-3(8)6(15(9,13)14)12-4(2)5(10)11/h1,5H
InChIKeyJJVMJNCHMWIKPY-UHFFFAOYSA-N
XLogP3.47
TPSA47.03 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500385.41
LogP ≤ 53.47
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 3,5-dibromo-6-(difluoromethyl)pyridine-2-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-dibromo-6-(difluoromethyl)pyridine-2-sulfonyl chloride?
The IUPAC name of 3,5-dibromo-6-(difluoromethyl)pyridine-2-sulfonyl chloride (CID 130099148) is 3,5-dibromo-6-(difluoromethyl)pyridine-2-sulfonyl chloride.
What is the SMILES notation for 3,5-dibromo-6-(difluoromethyl)pyridine-2-sulfonyl chloride?
The canonical SMILES for 3,5-dibromo-6-(difluoromethyl)pyridine-2-sulfonyl chloride is O=S(=O)(Cl)c1nc(C(F)F)c(Br)cc1Br.
What is the InChIKey of 3,5-dibromo-6-(difluoromethyl)pyridine-2-sulfonyl chloride?
The InChIKey is JJVMJNCHMWIKPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2Br2ClF2NO2S/c7-2-1-3(8)6(15(9,13)14)12-4(2)5(10)11/h1,5H.
What are the key properties of 3,5-dibromo-6-(difluoromethyl)pyridine-2-sulfonyl chloride?
3,5-dibromo-6-(difluoromethyl)pyridine-2-sulfonyl chloride has a molecular weight of 385.41 g/mol, XLogP of 3.47, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dibromo-6-(difluoromethyl)pyridine-2-sulfonyl chloride is sourced from PubChem (CID 130099148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).