C7H2Cl2F2N2 — CID 130099195
2,5-dichloro-3-(difluoromethyl)pyridine-4-carbonitrile (PubChem CID 130099195) has the molecular formula C7H2Cl2F2N2 and a molecular weight of 223.01 g/mol. Its IUPAC name is 2,5-dichloro-3-(difluoromethyl)pyridine-4-carbonitrile.
| Compound Name | 2,5-dichloro-3-(difluoromethyl)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 130099195 |
| Molecular Formula | C7H2Cl2F2N2 |
| Molecular Weight | 223.01 g/mol |
| Exact Mass | 221.96 |
| IUPAC Name | 2,5-dichloro-3-(difluoromethyl)pyridine-4-carbonitrile |
| SMILES | N#Cc1c(Cl)cnc(Cl)c1C(F)F |
| InChI | InChI=1S/C7H2Cl2F2N2/c8-4-2-13-6(9)5(7(10)11)3(4)1-12/h2,7H |
| InChIKey | XKRVNHJUWACUGV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.01 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|