C7H2Cl3F2NO — CID 130099468
4,5-dichloro-2-(difluoromethyl)pyridine-3-carbonyl chloride (PubChem CID 130099468) has the molecular formula C7H2Cl3F2NO and a molecular weight of 260.45 g/mol. Its IUPAC name is 4,5-dichloro-2-(difluoromethyl)pyridine-3-carbonyl chloride.
| Compound Name | 4,5-dichloro-2-(difluoromethyl)pyridine-3-carbonyl chloride |
|---|---|
| PubChem CID | 130099468 |
| Molecular Formula | C7H2Cl3F2NO |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 258.92 |
| IUPAC Name | 4,5-dichloro-2-(difluoromethyl)pyridine-3-carbonyl chloride |
| SMILES | O=C(Cl)c1c(C(F)F)ncc(Cl)c1Cl |
| InChI | InChI=1S/C7H2Cl3F2NO/c8-2-1-13-5(7(11)12)3(4(2)9)6(10)14/h1,7H |
| InChIKey | IRWQPXOSSWVNKF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|