C7H5Cl2F2N — CID 130099262
3,5-dichloro-2-(difluoromethyl)-4-methylpyridine (PubChem CID 130099262) has the molecular formula C7H5Cl2F2N and a molecular weight of 212.03 g/mol. Its IUPAC name is 3,5-dichloro-2-(difluoromethyl)-4-methylpyridine.
| Compound Name | 3,5-dichloro-2-(difluoromethyl)-4-methylpyridine |
|---|---|
| PubChem CID | 130099262 |
| Molecular Formula | C7H5Cl2F2N |
| Molecular Weight | 212.03 g/mol |
| Exact Mass | 210.98 |
| IUPAC Name | 3,5-dichloro-2-(difluoromethyl)-4-methylpyridine |
| SMILES | Cc1c(Cl)cnc(C(F)F)c1Cl |
| InChI | InChI=1S/C7H5Cl2F2N/c1-3-4(8)2-12-6(5(3)9)7(10)11/h2,7H,1H3 |
| InChIKey | XHZSATYRBHYSIX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.03 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |