C7H7ClF2N2O3S — CID 134686410
5-chloro-6-(difluoromethyl)-4-methoxypyridine-3-sulfonamide (PubChem CID 134686410) has the molecular formula C7H7ClF2N2O3S and a molecular weight of 272.66 g/mol. Its IUPAC name is 5-chloro-6-(difluoromethyl)-4-methoxypyridine-3-sulfonamide.
| Compound Name | 5-chloro-6-(difluoromethyl)-4-methoxypyridine-3-sulfonamide |
|---|---|
| PubChem CID | 134686410 |
| Molecular Formula | C7H7ClF2N2O3S |
| Molecular Weight | 272.66 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | 5-chloro-6-(difluoromethyl)-4-methoxypyridine-3-sulfonamide |
| SMILES | COc1c(S(N)(=O)=O)cnc(C(F)F)c1Cl |
| InChI | InChI=1S/C7H7ClF2N2O3S/c1-15-6-3(16(11,13)14)2-12-5(4(6)8)7(9)10/h2,7H,1H3,(H2,11,13,14) |
| InChIKey | IUQBKUVVPCKEQY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.66 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |