5-bromo-2-(difluoromethyl)-3-methoxypyridine-4-sulfonyl chloride

C7H5BrClF2NO3S — CID 130069032

IUPAC5-bromo-2-(difluoromethyl)-3-methoxypyridine-4-sulfonyl chloride
SMILESCOc1c(C(F)F)ncc(Br)c1S(=O)(=O)Cl
InChIInChI=1S/C7H5BrClF2NO3S/c1-15-5-4(7(10)11)12-2-3(8)6(5)16(9,13)14/h2,7H,1H3
InChIKeyPSZSCAJTDNMLKO-UHFFFAOYSA-N
MW336.54 g/mol
LogP2.72
Rot. Bonds3

About 5-bromo-2-(difluoromethyl)-3-methoxypyridine-4-sulfonyl chloride

5-bromo-2-(difluoromethyl)-3-methoxypyridine-4-sulfonyl chloride (PubChem CID 130069032) has the molecular formula C7H5BrClF2NO3S and a molecular weight of 336.54 g/mol. Its IUPAC name is 5-bromo-2-(difluoromethyl)-3-methoxypyridine-4-sulfonyl chloride.

Molecular Properties

Compound Name5-bromo-2-(difluoromethyl)-3-methoxypyridine-4-sulfonyl chloride
PubChem CID130069032
Molecular FormulaC7H5BrClF2NO3S
Molecular Weight336.54 g/mol
Exact Mass334.88
IUPAC Name5-bromo-2-(difluoromethyl)-3-methoxypyridine-4-sulfonyl chloride
SMILESCOc1c(C(F)F)ncc(Br)c1S(=O)(=O)Cl
InChIInChI=1S/C7H5BrClF2NO3S/c1-15-5-4(7(10)11)12-2-3(8)6(5)16(9,13)14/h2,7H,1H3
InChIKeyPSZSCAJTDNMLKO-UHFFFAOYSA-N
XLogP2.72
TPSA56.26 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500336.54
LogP ≤ 52.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 5-bromo-2-(difluoromethyl)-3-methoxypyridine-4-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-bromo-2-(difluoromethyl)-3-methoxypyridine-4-sulfonyl chloride?
The IUPAC name of 5-bromo-2-(difluoromethyl)-3-methoxypyridine-4-sulfonyl chloride (CID 130069032) is 5-bromo-2-(difluoromethyl)-3-methoxypyridine-4-sulfonyl chloride.
What is the SMILES notation for 5-bromo-2-(difluoromethyl)-3-methoxypyridine-4-sulfonyl chloride?
The canonical SMILES for 5-bromo-2-(difluoromethyl)-3-methoxypyridine-4-sulfonyl chloride is COc1c(C(F)F)ncc(Br)c1S(=O)(=O)Cl.
What is the InChIKey of 5-bromo-2-(difluoromethyl)-3-methoxypyridine-4-sulfonyl chloride?
The InChIKey is PSZSCAJTDNMLKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrClF2NO3S/c1-15-5-4(7(10)11)12-2-3(8)6(5)16(9,13)14/h2,7H,1H3.
What are the key properties of 5-bromo-2-(difluoromethyl)-3-methoxypyridine-4-sulfonyl chloride?
5-bromo-2-(difluoromethyl)-3-methoxypyridine-4-sulfonyl chloride has a molecular weight of 336.54 g/mol, XLogP of 2.72, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(difluoromethyl)-3-methoxypyridine-4-sulfonyl chloride is sourced from PubChem (CID 130069032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).