C6H2ClF4N — CID 130099578
2-chloro-4-(difluoromethyl)-3,5-difluoropyridine (PubChem CID 130099578) has the molecular formula C6H2ClF4N and a molecular weight of 199.53 g/mol. Its IUPAC name is 2-chloro-4-(difluoromethyl)-3,5-difluoropyridine.
| Compound Name | 2-chloro-4-(difluoromethyl)-3,5-difluoropyridine |
|---|---|
| PubChem CID | 130099578 |
| Molecular Formula | C6H2ClF4N |
| Molecular Weight | 199.53 g/mol |
| Exact Mass | 198.98 |
| IUPAC Name | 2-chloro-4-(difluoromethyl)-3,5-difluoropyridine |
| SMILES | Fc1cnc(Cl)c(F)c1C(F)F |
| InChI | InChI=1S/C6H2ClF4N/c7-5-4(9)3(6(10)11)2(8)1-12-5/h1,6H |
| InChIKey | UVCQVOCPIUXLTI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|