C7H4ClF4N — CID 130099800
6-(chloromethyl)-2-(difluoromethyl)-3,4-difluoropyridine (PubChem CID 130099800) has the molecular formula C7H4ClF4N and a molecular weight of 213.56 g/mol. Its IUPAC name is 6-(chloromethyl)-2-(difluoromethyl)-3,4-difluoropyridine.
| Compound Name | 6-(chloromethyl)-2-(difluoromethyl)-3,4-difluoropyridine |
|---|---|
| PubChem CID | 130099800 |
| Molecular Formula | C7H4ClF4N |
| Molecular Weight | 213.56 g/mol |
| Exact Mass | 213.00 |
| IUPAC Name | 6-(chloromethyl)-2-(difluoromethyl)-3,4-difluoropyridine |
| SMILES | Fc1cc(CCl)nc(C(F)F)c1F |
| InChI | InChI=1S/C7H4ClF4N/c8-2-3-1-4(9)5(10)6(13-3)7(11)12/h1,7H,2H2 |
| InChIKey | MEACMJGYOCOVLF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.56 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|