About 6-(difluoromethyl)-4,5-difluoropyridine-2-sulfonyl chloride
6-(difluoromethyl)-4,5-difluoropyridine-2-sulfonyl chloride (PubChem CID 130099948) has the molecular formula C6H2ClF4NO2S
and a molecular weight of 263.60 g/mol. Its IUPAC name is 6-(difluoromethyl)-4,5-difluoropyridine-2-sulfonyl chloride.
Analyze 6-(difluoromethyl)-4,5-difluoropyridine-2-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(difluoromethyl)-4,5-difluoropyridine-2-sulfonyl chloride?
The IUPAC name of 6-(difluoromethyl)-4,5-difluoropyridine-2-sulfonyl chloride (CID 130099948) is 6-(difluoromethyl)-4,5-difluoropyridine-2-sulfonyl chloride.
What is the SMILES notation for 6-(difluoromethyl)-4,5-difluoropyridine-2-sulfonyl chloride?
The canonical SMILES for 6-(difluoromethyl)-4,5-difluoropyridine-2-sulfonyl chloride is O=S(=O)(Cl)c1cc(F)c(F)c(C(F)F)n1.
What is the InChIKey of 6-(difluoromethyl)-4,5-difluoropyridine-2-sulfonyl chloride?
The InChIKey is AJCGAKGGYAFVOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2ClF4NO2S/c7-15(13,14)3-1-2(8)4(9)5(12-3)6(10)11/h1,6H.
What are the key properties of 6-(difluoromethyl)-4,5-difluoropyridine-2-sulfonyl chloride?
6-(difluoromethyl)-4,5-difluoropyridine-2-sulfonyl chloride has a molecular weight of 263.60 g/mol, XLogP of 2.22, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(difluoromethyl)-4,5-difluoropyridine-2-sulfonyl chloride is sourced from PubChem (CID 130099948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).