C6H4ClF2NO2 — CID 130099992
6-chloro-4-(difluoromethyl)-3-hydroxy-1H-pyridin-2-one (PubChem CID 130099992) has the molecular formula C6H4ClF2NO2 and a molecular weight of 195.55 g/mol. Its IUPAC name is 6-chloro-4-(difluoromethyl)-3-hydroxy-1H-pyridin-2-one.
| Compound Name | 6-chloro-4-(difluoromethyl)-3-hydroxy-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130099992 |
| Molecular Formula | C6H4ClF2NO2 |
| Molecular Weight | 195.55 g/mol |
| Exact Mass | 194.99 |
| IUPAC Name | 6-chloro-4-(difluoromethyl)-3-hydroxy-1H-pyridin-2-one |
| SMILES | O=c1[nH]c(Cl)cc(C(F)F)c1O |
| InChI | InChI=1S/C6H4ClF2NO2/c7-3-1-2(5(8)9)4(11)6(12)10-3/h1,5,11H,(H,10,12) |
| InChIKey | RAHCXBJITRQFSA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.55 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|