C6H2BrF2I2N — CID 130100414
3-bromo-6-(difluoromethyl)-2,4-diiodopyridine (PubChem CID 130100414) has the molecular formula C6H2BrF2I2N and a molecular weight of 459.80 g/mol. Its IUPAC name is 3-bromo-6-(difluoromethyl)-2,4-diiodopyridine.
| Compound Name | 3-bromo-6-(difluoromethyl)-2,4-diiodopyridine |
|---|---|
| PubChem CID | 130100414 |
| Molecular Formula | C6H2BrF2I2N |
| Molecular Weight | 459.80 g/mol |
| Exact Mass | 458.74 |
| IUPAC Name | 3-bromo-6-(difluoromethyl)-2,4-diiodopyridine |
| SMILES | FC(F)c1cc(I)c(Br)c(I)n1 |
| InChI | InChI=1S/C6H2BrF2I2N/c7-4-2(10)1-3(5(8)9)12-6(4)11/h1,5H |
| InChIKey | OZIFXOSIKFCEIA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.80 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|