C7H6F2I2N2 — CID 130100564
[2-(difluoromethyl)-5,6-diiodo-3-pyridinyl]methanamine (PubChem CID 130100564) has the molecular formula C7H6F2I2N2 and a molecular weight of 409.94 g/mol. Its IUPAC name is [2-(difluoromethyl)-5,6-diiodo-3-pyridinyl]methanamine.
| Compound Name | [2-(difluoromethyl)-5,6-diiodo-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 130100564 |
| Molecular Formula | C7H6F2I2N2 |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.86 |
| IUPAC Name | [2-(difluoromethyl)-5,6-diiodo-3-pyridinyl]methanamine |
| SMILES | NCc1cc(I)c(I)nc1C(F)F |
| InChI | InChI=1S/C7H6F2I2N2/c8-6(9)5-3(2-12)1-4(10)7(11)13-5/h1,6H,2,12H2 |
| InChIKey | LWCDRXDLKWIAEA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|