C7H8F2IN3 — CID 119017545
3-(aminomethyl)-6-(difluoromethyl)-5-iodopyridin-2-amine (PubChem CID 119017545) has the molecular formula C7H8F2IN3 and a molecular weight of 299.06 g/mol. Its IUPAC name is 3-(aminomethyl)-6-(difluoromethyl)-5-iodopyridin-2-amine.
| Compound Name | 3-(aminomethyl)-6-(difluoromethyl)-5-iodopyridin-2-amine |
|---|---|
| PubChem CID | 119017545 |
| Molecular Formula | C7H8F2IN3 |
| Molecular Weight | 299.06 g/mol |
| Exact Mass | 298.97 |
| IUPAC Name | 3-(aminomethyl)-6-(difluoromethyl)-5-iodopyridin-2-amine |
| SMILES | NCc1cc(I)c(C(F)F)nc1N |
| InChI | InChI=1S/C7H8F2IN3/c8-6(9)5-4(10)1-3(2-11)7(12)13-5/h1,6H,2,11H2,(H2,12,13) |
| InChIKey | UXDUQXPUNNXBOV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.06 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|