C7H8BrF2N3 — CID 130101856
6-(aminomethyl)-4-bromo-5-(difluoromethyl)pyridin-2-amine (PubChem CID 130101856) has the molecular formula C7H8BrF2N3 and a molecular weight of 252.06 g/mol. Its IUPAC name is 6-(aminomethyl)-4-bromo-5-(difluoromethyl)pyridin-2-amine.
| Compound Name | 6-(aminomethyl)-4-bromo-5-(difluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 130101856 |
| Molecular Formula | C7H8BrF2N3 |
| Molecular Weight | 252.06 g/mol |
| Exact Mass | 250.99 |
| IUPAC Name | 6-(aminomethyl)-4-bromo-5-(difluoromethyl)pyridin-2-amine |
| SMILES | NCc1nc(N)cc(Br)c1C(F)F |
| InChI | InChI=1S/C7H8BrF2N3/c8-3-1-5(12)13-4(2-11)6(3)7(9)10/h1,7H,2,11H2,(H2,12,13) |
| InChIKey | QJZJCGAIVRICOD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.06 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |