C7H10F2N4 — CID 118836943
6-(aminomethyl)-4-(difluoromethyl)pyridine-2,5-diamine (PubChem CID 118836943) has the molecular formula C7H10F2N4 and a molecular weight of 188.18 g/mol. Its IUPAC name is 6-(aminomethyl)-4-(difluoromethyl)pyridine-2,5-diamine.
| Compound Name | 6-(aminomethyl)-4-(difluoromethyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 118836943 |
| Molecular Formula | C7H10F2N4 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 6-(aminomethyl)-4-(difluoromethyl)pyridine-2,5-diamine |
| SMILES | NCc1nc(N)cc(C(F)F)c1N |
| InChI | InChI=1S/C7H10F2N4/c8-7(9)3-1-5(11)13-4(2-10)6(3)12/h1,7H,2,10,12H2,(H2,11,13) |
| InChIKey | UHMCAVSTWMBSRU-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |