C8H6BrF2N3 — CID 130102010
2-[6-amino-3-bromo-4-(difluoromethyl)-2-pyridinyl]acetonitrile (PubChem CID 130102010) has the molecular formula C8H6BrF2N3 and a molecular weight of 262.06 g/mol. Its IUPAC name is 2-[6-amino-3-bromo-4-(difluoromethyl)-2-pyridinyl]acetonitrile.
| Compound Name | 2-[6-amino-3-bromo-4-(difluoromethyl)-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 130102010 |
| Molecular Formula | C8H6BrF2N3 |
| Molecular Weight | 262.06 g/mol |
| Exact Mass | 260.97 |
| IUPAC Name | 2-[6-amino-3-bromo-4-(difluoromethyl)-2-pyridinyl]acetonitrile |
| SMILES | N#CCc1nc(N)cc(C(F)F)c1Br |
| InChI | InChI=1S/C8H6BrF2N3/c9-7-4(8(10)11)3-6(13)14-5(7)1-2-12/h3,8H,1H2,(H2,13,14) |
| InChIKey | RJEIBWHUXDIPGK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.06 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |