C7H6Cl2F2N2 — CID 130102739
2-chloro-6-(chloromethyl)-3-(difluoromethyl)pyridin-4-amine (PubChem CID 130102739) has the molecular formula C7H6Cl2F2N2 and a molecular weight of 227.04 g/mol. Its IUPAC name is 2-chloro-6-(chloromethyl)-3-(difluoromethyl)pyridin-4-amine.
| Compound Name | 2-chloro-6-(chloromethyl)-3-(difluoromethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 130102739 |
| Molecular Formula | C7H6Cl2F2N2 |
| Molecular Weight | 227.04 g/mol |
| Exact Mass | 225.99 |
| IUPAC Name | 2-chloro-6-(chloromethyl)-3-(difluoromethyl)pyridin-4-amine |
| SMILES | Nc1cc(CCl)nc(Cl)c1C(F)F |
| InChI | InChI=1S/C7H6Cl2F2N2/c8-2-3-1-4(12)5(7(10)11)6(9)13-3/h1,7H,2H2,(H2,12,13) |
| InChIKey | BDZUJRWIVFDXMZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.04 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|