C7H8ClF2N3 — CID 118997828
6-(aminomethyl)-4-chloro-3-(difluoromethyl)pyridin-2-amine (PubChem CID 118997828) has the molecular formula C7H8ClF2N3 and a molecular weight of 207.61 g/mol. Its IUPAC name is 6-(aminomethyl)-4-chloro-3-(difluoromethyl)pyridin-2-amine.
| Compound Name | 6-(aminomethyl)-4-chloro-3-(difluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 118997828 |
| Molecular Formula | C7H8ClF2N3 |
| Molecular Weight | 207.61 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 6-(aminomethyl)-4-chloro-3-(difluoromethyl)pyridin-2-amine |
| SMILES | NCc1cc(Cl)c(C(F)F)c(N)n1 |
| InChI | InChI=1S/C7H8ClF2N3/c8-4-1-3(2-11)13-7(12)5(4)6(9)10/h1,6H,2,11H2,(H2,12,13) |
| InChIKey | JUJIBGLKTJKKSK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.61 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |