C8H11F2N3 — CID 130106302
5-(aminomethyl)-2-(difluoromethyl)-4-methylpyridin-3-amine (PubChem CID 130106302) has the molecular formula C8H11F2N3 and a molecular weight of 187.19 g/mol. Its IUPAC name is 5-(aminomethyl)-2-(difluoromethyl)-4-methylpyridin-3-amine.
| Compound Name | 5-(aminomethyl)-2-(difluoromethyl)-4-methylpyridin-3-amine |
|---|---|
| PubChem CID | 130106302 |
| Molecular Formula | C8H11F2N3 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | 5-(aminomethyl)-2-(difluoromethyl)-4-methylpyridin-3-amine |
| SMILES | Cc1c(CN)cnc(C(F)F)c1N |
| InChI | InChI=1S/C8H11F2N3/c1-4-5(2-11)3-13-7(6(4)12)8(9)10/h3,8H,2,11-12H2,1H3 |
| InChIKey | GXYKQNNJDQHWPA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |